C21H33FN2O5 — CID 176700378
(1-propanoylpyrrolidin-3-yl) N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate (PubChem CID 176700378) has the molecular formula C21H33FN2O5 and a molecular weight of 412.50 g/mol. Its IUPAC name is (1-propanoylpyrrolidin-3-yl) N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate.
| Compound Name | (1-propanoylpyrrolidin-3-yl) N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700378 |
| Molecular Formula | C21H33FN2O5 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (1-propanoylpyrrolidin-3-yl) N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate |
| SMILES | C=C(F)/C=C(/OCCOCCNC(=O)OC1CCN(C(=O)CC)C1)C(=C)C(C)C |
| InChI | InChI=1S/C21H33FN2O5/c1-6-20(25)24-9-7-18(14-24)29-21(26)23-8-10-27-11-12-28-19(13-16(4)22)17(5)15(2)3/h13,15,18H,4-12,14H2,1-3H3,(H,23,26)/b19-13+ |
| InChIKey | BSDRWXIIXXHCIK-CPNJWEJPSA-N |
| XLogP | 3.34 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|