C20H40N2O6 — CID 171833589
ethane;N-[2-[2-[2-[3-(4-methoxypiperidin-1-yl)-3-oxopropoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 171833589) has the molecular formula C20H40N2O6 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethane;N-[2-[2-[2-[3-(4-methoxypiperidin-1-yl)-3-oxopropoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | ethane;N-[2-[2-[2-[3-(4-methoxypiperidin-1-yl)-3-oxopropoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 171833589 |
| Molecular Formula | C20H40N2O6 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | ethane;N-[2-[2-[2-[3-(4-methoxypiperidin-1-yl)-3-oxopropoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC.CCC(=O)NCCOCCOCCOCCC(=O)N1CCC(OC)CC1 |
| InChI | InChI=1S/C18H34N2O6.C2H6/c1-3-17(21)19-7-11-25-13-15-26-14-12-24-10-6-18(22)20-8-4-16(23-2)5-9-20;1-2/h16H,3-15H2,1-2H3,(H,19,21);1-2H3 |
| InChIKey | SSCMHENRJASQAG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|