C22H34F2N2O5 — CID 176701184
[3-(fluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate;molecular hydrogen (PubChem CID 176701184) has the molecular formula C22H34F2N2O5 and a molecular weight of 444.52 g/mol. Its IUPAC name is [3-(fluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate;molecular hydrogen.
| Compound Name | [3-(fluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 176701184 |
| Molecular Formula | C22H34F2N2O5 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | [3-(fluoromethyl)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethoxy]ethyl]carbamate;molecular hydrogen |
| SMILES | C=CC(=O)N1CCC(CF)(OC(=O)NCCOCCO/C(=C/C(=C)F)C(=C)C(C)C)C1.[H][H] |
| InChI | InChI=1S/C22H32F2N2O5.H2/c1-6-20(27)26-9-7-22(14-23,15-26)31-21(28)25-8-10-29-11-12-30-19(13-17(4)24)18(5)16(2)3;/h6,13,16H,1,4-5,7-12,14-15H2,2-3H3,(H,25,28);1H/b19-13+; |
| InChIKey | UXMZAPNLTPDCKO-XTWSRORZSA-N |
| XLogP | 3.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|