C18H21F3N2O4 — CID 172889677
3-hydroxy-1-prop-2-enoyl-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyrrolidine-3-carboxamide (PubChem CID 172889677) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-hydroxy-1-prop-2-enoyl-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 3-hydroxy-1-prop-2-enoyl-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 172889677 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-hydroxy-1-prop-2-enoyl-N-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyrrolidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(O)(C(=O)NCCc2ccc(OCC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H21F3N2O4/c1-2-15(24)23-10-8-17(26,11-23)16(25)22-9-7-13-3-5-14(6-4-13)27-12-18(19,20)21/h2-6,26H,1,7-12H2,(H,22,25) |
| InChIKey | JNQHEAHZHYYNSB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|