C17H23FN2O4 — CID 128987481
1-acetyl-N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 128987481) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-acetyl-N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 128987481 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-acetyl-N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(O)CCCN(C(C)=O)C2)cc1F |
| InChI | InChI=1S/C17H23FN2O4/c1-12(21)20-9-3-7-17(23,11-20)16(22)19-8-6-13-4-5-15(24-2)14(18)10-13/h4-5,10,23H,3,6-9,11H2,1-2H3,(H,19,22) |
| InChIKey | PNRHTZNNYBJIOC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |