C17H23ClN2O4 — CID 129345760
(3R)-1-acetyl-N-[2-(2-chloro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 129345760) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is (3R)-1-acetyl-N-[2-(2-chloro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide.
| Compound Name | (3R)-1-acetyl-N-[2-(2-chloro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129345760 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (3R)-1-acetyl-N-[2-(2-chloro-4-methoxyphenyl)ethyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@@]2(O)CCCN(C(C)=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-12(21)20-9-3-7-17(23,11-20)16(22)19-8-6-13-4-5-14(24-2)10-15(13)18/h4-5,10,23H,3,6-9,11H2,1-2H3,(H,19,22)/t17-/m1/s1 |
| InChIKey | WQPUDZUNXAMYBN-QGZVFWFLSA-N |
| XLogP | 1.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |