C16H21FN2O4 — CID 129345621
(3S)-1-acetyl-N-[(3-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 129345621) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is (3S)-1-acetyl-N-[(3-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidine-3-carboxamide.
| Compound Name | (3S)-1-acetyl-N-[(3-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129345621 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3S)-1-acetyl-N-[(3-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | COc1cc(F)cc(CNC(=O)[C@]2(O)CCCN(C(C)=O)C2)c1 |
| InChI | InChI=1S/C16H21FN2O4/c1-11(20)19-5-3-4-16(22,10-19)15(21)18-9-12-6-13(17)8-14(7-12)23-2/h6-8,22H,3-5,9-10H2,1-2H3,(H,18,21)/t16-/m0/s1 |
| InChIKey | FRUJYUWFOZXENU-INIZCTEOSA-N |
| XLogP | 0.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |