C14H17FN2O — CID 176701007
2-[[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]pyrazine (PubChem CID 176701007) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-[[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]pyrazine.
| Compound Name | 2-[[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]pyrazine |
|---|---|
| PubChem CID | 176701007 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]pyrazine |
| SMILES | C=C(F)/C=C(/OCc1cnccn1)C(=C)C(C)C |
| InChI | InChI=1S/C14H17FN2O/c1-10(2)12(4)14(7-11(3)15)18-9-13-8-16-5-6-17-13/h5-8,10H,3-4,9H2,1-2H3/b14-7+ |
| InChIKey | RZIYQQUENGZNCR-VGOFMYFVSA-N |
| XLogP | 3.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|