C11H14N2O — CID 123522750
2-methyl-6-(penta-2,4-dien-2-yloxymethyl)pyrazine (PubChem CID 123522750) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-methyl-6-(penta-2,4-dien-2-yloxymethyl)pyrazine.
| Compound Name | 2-methyl-6-(penta-2,4-dien-2-yloxymethyl)pyrazine |
|---|---|
| PubChem CID | 123522750 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-methyl-6-(penta-2,4-dien-2-yloxymethyl)pyrazine |
| SMILES | C=CC=C(C)OCc1cncc(C)n1 |
| InChI | InChI=1S/C11H14N2O/c1-4-5-10(3)14-8-11-7-12-6-9(2)13-11/h4-7H,1,8H2,2-3H3 |
| InChIKey | OIWMMFCESUBDJR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|