C14H21FO2 — CID 176701504
4-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyoxane (PubChem CID 176701504) has the molecular formula C14H21FO2 and a molecular weight of 240.32 g/mol. Its IUPAC name is 4-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyoxane.
| Compound Name | 4-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyoxane |
|---|---|
| PubChem CID | 176701504 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyoxane |
| SMILES | C=C(F)/C=C(/OC1CCOCC1)C(=C)C(C)C |
| InChI | InChI=1S/C14H21FO2/c1-10(2)12(4)14(9-11(3)15)17-13-5-7-16-8-6-13/h9-10,13H,3-8H2,1-2H3/b14-9+ |
| InChIKey | WYNMDFZZOMEENT-NTEUORMPSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|