C35H32F2N6O3S — CID 176701597
1-[2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-6-yl)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one (PubChem CID 176701597) has the molecular formula C35H32F2N6O3S and a molecular weight of 654.74 g/mol. Its IUPAC name is 1-[2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-6-yl)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-6-yl)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176701597 |
| Molecular Formula | C35H32F2N6O3S |
| Molecular Weight | 654.74 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 1-[2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-6-yl)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)n2nc(-c3nc(-c4ccc5cn(C)nc5c4)c4ccsc4c3-c3c(F)cc(F)cc3OCCOC)cc2C1C |
| InChI | InChI=1S/C35H32F2N6O3S/c1-6-30(44)42-17-19(2)43-28(20(42)3)16-27(40-43)34-32(31-25(37)14-23(36)15-29(31)46-11-10-45-5)35-24(9-12-47-35)33(38-34)21-7-8-22-18-41(4)39-26(22)13-21/h6-9,12-16,18-20H,1,10-11,17H2,2-5H3 |
| InChIKey | FSBPXRFSVWEOPH-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|