C32H29F3N6O2S — CID 176702867
4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-5-[(4R,7S)-4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]-3-fluoro-7-(1-methylbenzimidazol-5-yl)thieno[2,3-c]pyridine (PubChem CID 176702867) has the molecular formula C32H29F3N6O2S and a molecular weight of 618.69 g/mol. Its IUPAC name is 4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-5-[(4R,7S)-4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]-3-fluoro-7-(1-methylbenzimidazol-5-yl)thieno[2,3-c]pyridine.
| Compound Name | 4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-5-[(4R,7S)-4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]-3-fluoro-7-(1-methylbenzimidazol-5-yl)thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 176702867 |
| Molecular Formula | C32H29F3N6O2S |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | 4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-5-[(4R,7S)-4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]-3-fluoro-7-(1-methylbenzimidazol-5-yl)thieno[2,3-c]pyridine |
| SMILES | COCCOc1cc(F)cc(F)c1-c1c(-c2cc3n(n2)[C@@H](C)CN[C@@H]3C)nc(-c2ccc3c(c2)ncn3C)c2scc(F)c12 |
| InChI | InChI=1S/C32H29F3N6O2S/c1-16-13-36-17(2)25-12-23(39-41(16)25)31-29(27-20(34)10-19(33)11-26(27)43-8-7-42-4)28-21(35)14-44-32(28)30(38-31)18-5-6-24-22(9-18)37-15-40(24)3/h5-6,9-12,14-17,36H,7-8,13H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | NORFLJWGBXKPAA-DLBZAZTESA-N |
| XLogP | 7.05 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|