C32H29F2N5O4S — CID 176703016
7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)-N-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]thieno[3,2-c]pyridine-6-carboxamide (PubChem CID 176703016) has the molecular formula C32H29F2N5O4S and a molecular weight of 617.68 g/mol. Its IUPAC name is 7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)-N-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]thieno[3,2-c]pyridine-6-carboxamide.
| Compound Name | 7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)-N-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]thieno[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 176703016 |
| Molecular Formula | C32H29F2N5O4S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)-N-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]thieno[3,2-c]pyridine-6-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](NC(=O)c2nc(-c3ccc4c(cnn4C)c3)c3ccsc3c2-c2c(F)cc(F)cc2OCCOC)C1 |
| InChI | InChI=1S/C32H29F2N5O4S/c1-4-26(40)39-9-7-21(17-39)36-32(41)30-28(27-23(34)14-20(33)15-25(27)43-11-10-42-3)31-22(8-12-44-31)29(37-30)18-5-6-24-19(13-18)16-35-38(24)2/h4-6,8,12-16,21H,1,7,9-11,17H2,2-3H3,(H,36,41)/t21-/m0/s1 |
| InChIKey | AOUSCFWNVLMDMG-NRFANRHFSA-N |
| XLogP | 5.34 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|