C27H35ClFN7O2 — CID 176704254
(E)-2-amino-3-chloro-3-[1-[7-(2-ethyl-3-fluorophenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide (PubChem CID 176704254) has the molecular formula C27H35ClFN7O2 and a molecular weight of 544.08 g/mol. Its IUPAC name is (E)-2-amino-3-chloro-3-[1-[7-(2-ethyl-3-fluorophenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-2-amino-3-chloro-3-[1-[7-(2-ethyl-3-fluorophenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 176704254 |
| Molecular Formula | C27H35ClFN7O2 |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | (E)-2-amino-3-chloro-3-[1-[7-(2-ethyl-3-fluorophenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CCc1c(F)cccc1C1Cc2nc(OC)nc(N3CCCN=C(/C(Cl)=C(\N)C(=O)N(C)C)C3)c2CN1C |
| InChI | InChI=1S/C27H35ClFN7O2/c1-6-16-17(9-7-10-19(16)29)22-13-20-18(14-35(22)4)25(33-27(32-20)38-5)36-12-8-11-31-21(15-36)23(28)24(30)26(37)34(2)3/h7,9-10,22H,6,8,11-15,30H2,1-5H3/b24-23+ |
| InChIKey | SHPVYAVEXFPRQW-WCWDXBQESA-N |
| XLogP | 3.06 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|