C15H27NO2 — CID 176706083
[(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol;methanol (PubChem CID 176706083) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol;methanol.
| Compound Name | [(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol;methanol |
|---|---|
| PubChem CID | 176706083 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpiperidin-4-yl]methanol;methanol |
| SMILES | C=C/C=C(\C=C)CN1CC[C@@H](CO)C[C@H]1C.CO |
| InChI | InChI=1S/C14H23NO.CH4O/c1-4-6-13(5-2)10-15-8-7-14(11-16)9-12(15)3;1-2/h4-6,12,14,16H,1-2,7-11H2,3H3;2H,1H3/b13-6+;/t12-,14-;/m1./s1 |
| InChIKey | BRGMIKGTXVBMLU-XGTMXKNUSA-N |
| XLogP | 1.99 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|