C25H28N6O3 — CID 176706138
3-amino-6-[1-(2-amino-2-oxoethyl)indol-6-yl]-N-(5-hydroxy-2-adamantyl)pyrazine-2-carboxamide (PubChem CID 176706138) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-amino-6-[1-(2-amino-2-oxoethyl)indol-6-yl]-N-(5-hydroxy-2-adamantyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[1-(2-amino-2-oxoethyl)indol-6-yl]-N-(5-hydroxy-2-adamantyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 176706138 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-amino-6-[1-(2-amino-2-oxoethyl)indol-6-yl]-N-(5-hydroxy-2-adamantyl)pyrazine-2-carboxamide |
| SMILES | NC(=O)Cn1ccc2ccc(-c3cnc(N)c(C(=O)NC4C5CC6CC4CC(O)(C6)C5)n3)cc21 |
| InChI | InChI=1S/C25H28N6O3/c26-20(32)12-31-4-3-14-1-2-15(7-19(14)31)18-11-28-23(27)22(29-18)24(33)30-21-16-5-13-6-17(21)10-25(34,8-13)9-16/h1-4,7,11,13,16-17,21,34H,5-6,8-10,12H2,(H2,26,32)(H2,27,28)(H,30,33) |
| InChIKey | LXIBBTODYYNVIX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|