C13H20B2N2O5 — CID 176706795
CID 176706795 (PubChem CID 176706795) has the molecular formula C13H20B2N2O5 and a molecular weight of 305.94 g/mol.
| Compound Name | CID 176706795 |
|---|---|
| PubChem CID | 176706795 |
| Molecular Formula | C13H20B2N2O5 |
| Molecular Weight | 305.94 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC(CC(NC(=O)OC(C)(C)C)C(=O)OC)C(=O)N1 |
| InChI | InChI=1S/C13H20B2N2O5/c1-12(2,3)22-11(20)16-8(10(19)21-4)5-7-6-13(14,15)17-9(7)18/h7-8H,5-6H2,1-4H3,(H,16,20)(H,17,18) |
| InChIKey | GQJQDBYVVLPZRZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.94 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|