C15H26BN2O5 — CID 174037593
CID 174037593 (PubChem CID 174037593) has the molecular formula C15H26BN2O5 and a molecular weight of 325.19 g/mol.
| Compound Name | CID 174037593 |
|---|---|
| PubChem CID | 174037593 |
| Molecular Formula | C15H26BN2O5 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | — |
| SMILES | C[B]CC1C[C@@H](C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)C(=O)N1 |
| InChI | InChI=1S/C15H26BN2O5/c1-15(2,3)23-14(21)18-11(13(20)22-5)7-9-6-10(8-16-4)17-12(9)19/h9-11H,6-8H2,1-5H3,(H,17,19)(H,18,21)/t9-,10?,11-/m0/s1 |
| InChIKey | NRBFOPGWBCVWKU-JRUYECLLSA-N |
| XLogP | 1.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|