C24H21N3O5 — CID 176709501
methyl 2-[2-[3-oxo-7-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate (PubChem CID 176709501) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is methyl 2-[2-[3-oxo-7-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[3-oxo-7-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 176709501 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | methyl 2-[2-[3-oxo-7-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)C(=C)N1Cc2c(cccc2-c2ccc3c(c2)CCC(=O)N3)C1=O)C(=O)OC |
| InChI | InChI=1S/C24H21N3O5/c1-13(24(31)32-3)25-22(29)14(2)27-12-19-17(5-4-6-18(19)23(27)30)15-7-9-20-16(11-15)8-10-21(28)26-20/h4-7,9,11H,1-2,8,10,12H2,3H3,(H,25,29)(H,26,28) |
| InChIKey | ZUOPUUIBKIOWGR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|