C25H29N3O4 — CID 176709073
acetaldehyde;methyl 2-[2-[8-[4-(methylamino)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-enoylamino]prop-2-enoate (PubChem CID 176709073) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is acetaldehyde;methyl 2-[2-[8-[4-(methylamino)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-enoylamino]prop-2-enoate.
| Compound Name | acetaldehyde;methyl 2-[2-[8-[4-(methylamino)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 176709073 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | acetaldehyde;methyl 2-[2-[8-[4-(methylamino)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)C(=C)N1CCc2cccc(-c3ccc(NC)cc3)c2C1)C(=O)OC.CC=O |
| InChI | InChI=1S/C23H25N3O3.C2H4O/c1-15(23(28)29-4)25-22(27)16(2)26-13-12-17-6-5-7-20(21(17)14-26)18-8-10-19(24-3)11-9-18;1-2-3/h5-11,24H,1-2,12-14H2,3-4H3,(H,25,27);2H,1H3 |
| InChIKey | RYNQDDBIFNUDOL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|