C21H21N5O4 — CID 176709331
methyl 2-[2-[7-(3-amino-4-hydrazinylphenyl)-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate (PubChem CID 176709331) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 2-[2-[7-(3-amino-4-hydrazinylphenyl)-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[7-(3-amino-4-hydrazinylphenyl)-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 176709331 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | methyl 2-[2-[7-(3-amino-4-hydrazinylphenyl)-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)C(=C)N1Cc2c(cccc2-c2ccc(NN)c(N)c2)C1=O)C(=O)OC |
| InChI | InChI=1S/C21H21N5O4/c1-11(21(29)30-3)24-19(27)12(2)26-10-16-14(5-4-6-15(16)20(26)28)13-7-8-18(25-23)17(22)9-13/h4-9,25H,1-2,10,22-23H2,3H3,(H,24,27) |
| InChIKey | MRHHXADYCZUXMW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|