C26H24N4O6 — CID 176708967
methyl 2-[2-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate (PubChem CID 176708967) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is methyl 2-[2-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 176708967 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | methyl 2-[2-[7-[4-[(1-carbamoylcyclopropanecarbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)C(=C)N1Cc2c(cccc2-c2ccc(NC(=O)C3(C(N)=O)CC3)cc2)C1=O)C(=O)OC |
| InChI | InChI=1S/C26H24N4O6/c1-14(23(33)36-3)28-21(31)15(2)30-13-20-18(5-4-6-19(20)22(30)32)16-7-9-17(10-8-16)29-25(35)26(11-12-26)24(27)34/h4-10H,1-2,11-13H2,3H3,(H2,27,34)(H,28,31)(H,29,35) |
| InChIKey | KWGWUFRSLHXKND-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|