C23H20N4O5 — CID 176709395
methyl 2-[2-[5-(4-acetamidophenyl)-1-oxophthalazin-2-yl]prop-2-enoylamino]prop-2-enoate (PubChem CID 176709395) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is methyl 2-[2-[5-(4-acetamidophenyl)-1-oxophthalazin-2-yl]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[5-(4-acetamidophenyl)-1-oxophthalazin-2-yl]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 176709395 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl 2-[2-[5-(4-acetamidophenyl)-1-oxophthalazin-2-yl]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)C(=C)n1ncc2c(-c3ccc(NC(C)=O)cc3)cccc2c1=O)C(=O)OC |
| InChI | InChI=1S/C23H20N4O5/c1-13(23(31)32-4)25-21(29)14(2)27-22(30)19-7-5-6-18(20(19)12-24-27)16-8-10-17(11-9-16)26-15(3)28/h5-12H,1-2H2,3-4H3,(H,25,29)(H,26,28) |
| InChIKey | ZGJPQWXWPNYERU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|