C19H18N4O6 — CID 169151278
methyl 2-[2-[[2-(4-acetamidophenyl)-1,3-oxazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate (PubChem CID 169151278) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is methyl 2-[2-[[2-(4-acetamidophenyl)-1,3-oxazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[[2-(4-acetamidophenyl)-1,3-oxazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 169151278 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | methyl 2-[2-[[2-(4-acetamidophenyl)-1,3-oxazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)c1coc(-c2ccc(NC(C)=O)cc2)n1)C(=O)NC(=C)C(=O)OC |
| InChI | InChI=1S/C19H18N4O6/c1-10(16(25)21-11(2)19(27)28-4)20-17(26)15-9-29-18(23-15)13-5-7-14(8-6-13)22-12(3)24/h5-9H,1-2H2,3-4H3,(H,20,26)(H,21,25)(H,22,24) |
| InChIKey | KERHSNVFGYKNRM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 139.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|