C20H21N5O5 — CID 174100698
2-(4-acetamidophenyl)-N-[1-[(1-amino-1-oxobut-2-en-2-yl)amino]-1-oxobut-2-en-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 174100698) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-[1-[(1-amino-1-oxobut-2-en-2-yl)amino]-1-oxobut-2-en-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(4-acetamidophenyl)-N-[1-[(1-amino-1-oxobut-2-en-2-yl)amino]-1-oxobut-2-en-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 174100698 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-[1-[(1-amino-1-oxobut-2-en-2-yl)amino]-1-oxobut-2-en-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | CC=C(NC(=O)C(=CC)NC(=O)c1coc(-c2ccc(NC(C)=O)cc2)n1)C(N)=O |
| InChI | InChI=1S/C20H21N5O5/c1-4-14(17(21)27)23-18(28)15(5-2)24-19(29)16-10-30-20(25-16)12-6-8-13(9-7-12)22-11(3)26/h4-10H,1-3H3,(H2,21,27)(H,22,26)(H,23,28)(H,24,29) |
| InChIKey | CVGYZDHJYMSFMH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|