C15H11IN4O2 — CID 3273917
2-(6-amino-3-pyridinyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 3273917) has the molecular formula C15H11IN4O2 and a molecular weight of 406.18 g/mol. Its IUPAC name is 2-(6-amino-3-pyridinyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(6-amino-3-pyridinyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3273917 |
| Molecular Formula | C15H11IN4O2 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 2-(6-amino-3-pyridinyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccc(-c2nc(C(=O)Nc3ccc(I)cc3)co2)cn1 |
| InChI | InChI=1S/C15H11IN4O2/c16-10-2-4-11(5-3-10)19-14(21)12-8-22-15(20-12)9-1-6-13(17)18-7-9/h1-8H,(H2,17,18)(H,19,21) |
| InChIKey | VCVWCOAQMHBDHU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|