C13H14IN3O3 — CID 3862698
2-(1-amino-2-hydroxypropyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 3862698) has the molecular formula C13H14IN3O3 and a molecular weight of 387.18 g/mol. Its IUPAC name is 2-(1-amino-2-hydroxypropyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-hydroxypropyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3862698 |
| Molecular Formula | C13H14IN3O3 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2-(1-amino-2-hydroxypropyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(O)C(N)c1nc(C(=O)Nc2ccc(I)cc2)co1 |
| InChI | InChI=1S/C13H14IN3O3/c1-7(18)11(15)13-17-10(6-20-13)12(19)16-9-4-2-8(14)3-5-9/h2-7,11,18H,15H2,1H3,(H,16,19) |
| InChIKey | MQPWEHOCXFJTGV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|