C20H20N4O4 — CID 3864832
N-[4-(4-aminobenzoyl)phenyl]-2-(1-amino-2-hydroxypropyl)-1,3-oxazole-4-carboxamide (PubChem CID 3864832) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[4-(4-aminobenzoyl)phenyl]-2-(1-amino-2-hydroxypropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-(4-aminobenzoyl)phenyl]-2-(1-amino-2-hydroxypropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3864832 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[4-(4-aminobenzoyl)phenyl]-2-(1-amino-2-hydroxypropyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(O)C(N)c1nc(C(=O)Nc2ccc(C(=O)c3ccc(N)cc3)cc2)co1 |
| InChI | InChI=1S/C20H20N4O4/c1-11(25)17(22)20-24-16(10-28-20)19(27)23-15-8-4-13(5-9-15)18(26)12-2-6-14(21)7-3-12/h2-11,17,25H,21-22H2,1H3,(H,23,27) |
| InChIKey | NNFGDVXRDARKCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 144.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|