C21H22N4O3 — CID 3862852
N-[4-(4-aminobenzoyl)phenyl]-2-(1-aminobutyl)-1,3-oxazole-4-carboxamide (PubChem CID 3862852) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[4-(4-aminobenzoyl)phenyl]-2-(1-aminobutyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-(4-aminobenzoyl)phenyl]-2-(1-aminobutyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3862852 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[4-(4-aminobenzoyl)phenyl]-2-(1-aminobutyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)Nc2ccc(C(=O)c3ccc(N)cc3)cc2)co1 |
| InChI | InChI=1S/C21H22N4O3/c1-2-3-17(23)21-25-18(12-28-21)20(27)24-16-10-6-14(7-11-16)19(26)13-4-8-15(22)9-5-13/h4-12,17H,2-3,22-23H2,1H3,(H,24,27) |
| InChIKey | RBOHHDQUJOUGQU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|