C18H24N4O3 — CID 3261325
2-(1-aminobutyl)-N-(4-morpholin-4-ylphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 3261325) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-(1-aminobutyl)-N-(4-morpholin-4-ylphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminobutyl)-N-(4-morpholin-4-ylphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3261325 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-(1-aminobutyl)-N-(4-morpholin-4-ylphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)Nc2ccc(N3CCOCC3)cc2)co1 |
| InChI | InChI=1S/C18H24N4O3/c1-2-3-15(19)18-21-16(12-25-18)17(23)20-13-4-6-14(7-5-13)22-8-10-24-11-9-22/h4-7,12,15H,2-3,8-11,19H2,1H3,(H,20,23) |
| InChIKey | UJKXZANUYOCSSY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|