C17H20N4O3 — CID 121066972
1-ethyl-N-(4-morpholin-4-ylphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 121066972) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-ethyl-N-(4-morpholin-4-ylphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-ethyl-N-(4-morpholin-4-ylphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121066972 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-ethyl-N-(4-morpholin-4-ylphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCn1nc(C(=O)Nc2ccc(N3CCOCC3)cc2)ccc1=O |
| InChI | InChI=1S/C17H20N4O3/c1-2-21-16(22)8-7-15(19-21)17(23)18-13-3-5-14(6-4-13)20-9-11-24-12-10-20/h3-8H,2,9-12H2,1H3,(H,18,23) |
| InChIKey | DCTVJLLGBCHWDV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|