C20H27N5O5 — CID 141228350
2-[(1S)-1-aminoethyl]-N-[(2R)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 141228350) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-N-[(2R)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(1S)-1-aminoethyl]-N-[(2R)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 141228350 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-N-[(2R)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(O)[C@@H](NC(=O)c1coc([C@H](C)N)n1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H27N5O5/c1-12(21)20-23-16(11-30-20)18(27)24-17(13(2)26)19(28)22-14-3-5-15(6-4-14)25-7-9-29-10-8-25/h3-6,11-13,17,26H,7-10,21H2,1-2H3,(H,22,28)(H,24,27)/t12-,13?,17+/m0/s1 |
| InChIKey | OQXZJNHAUHBHLP-GFMNRZNCSA-N |
| XLogP | 0.65 |
| TPSA | 142.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|