C12H12IN3O2 — CID 5182510
2-(1-aminoethyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 5182510) has the molecular formula C12H12IN3O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 5182510 |
| Molecular Formula | C12H12IN3O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-(1-aminoethyl)-N-(4-iodophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)Nc2ccc(I)cc2)co1 |
| InChI | InChI=1S/C12H12IN3O2/c1-7(14)12-16-10(6-18-12)11(17)15-9-4-2-8(13)3-5-9/h2-7H,14H2,1H3,(H,15,17) |
| InChIKey | STTNKGCLBADUFN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|