C19H19N3O2 — CID 5103089
2-(1-aminoethyl)-N-benzhydryl-1,3-oxazole-4-carboxamide (PubChem CID 5103089) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-benzhydryl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-benzhydryl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 5103089 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(1-aminoethyl)-N-benzhydryl-1,3-oxazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)NC(c2ccccc2)c2ccccc2)co1 |
| InChI | InChI=1S/C19H19N3O2/c1-13(20)19-21-16(12-24-19)18(23)22-17(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-13,17H,20H2,1H3,(H,22,23) |
| InChIKey | NFTVMBQWAWPZEI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |