C22H25N3O2 — CID 3821910
2-(1-amino-3-methylbutyl)-N-benzhydryl-1,3-oxazole-4-carboxamide (PubChem CID 3821910) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(1-amino-3-methylbutyl)-N-benzhydryl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-3-methylbutyl)-N-benzhydryl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3821910 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-(1-amino-3-methylbutyl)-N-benzhydryl-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)CC(N)c1nc(C(=O)NC(c2ccccc2)c2ccccc2)co1 |
| InChI | InChI=1S/C22H25N3O2/c1-15(2)13-18(23)22-24-19(14-27-22)21(26)25-20(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14-15,18,20H,13,23H2,1-2H3,(H,25,26) |
| InChIKey | ZKZKKGAKXQTGPI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |