C23H19N3O2 — CID 3835810
2-(4-aminophenyl)-N-benzhydryl-1,3-oxazole-4-carboxamide (PubChem CID 3835810) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-benzhydryl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(4-aminophenyl)-N-benzhydryl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3835810 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-(4-aminophenyl)-N-benzhydryl-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccc(-c2nc(C(=O)NC(c3ccccc3)c3ccccc3)co2)cc1 |
| InChI | InChI=1S/C23H19N3O2/c24-19-13-11-18(12-14-19)23-25-20(15-28-23)22(27)26-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,21H,24H2,(H,26,27) |
| InChIKey | FLIZIZYSJIQFTC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|