C23H28N4O2 — CID 3866544
2-(1-amino-2-methylbutyl)-N-[4-[2-(4-aminophenyl)ethyl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 3866544) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(1-amino-2-methylbutyl)-N-[4-[2-(4-aminophenyl)ethyl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-methylbutyl)-N-[4-[2-(4-aminophenyl)ethyl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3866544 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-(1-amino-2-methylbutyl)-N-[4-[2-(4-aminophenyl)ethyl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCC(C)C(N)c1nc(C(=O)Nc2ccc(CCc3ccc(N)cc3)cc2)co1 |
| InChI | InChI=1S/C23H28N4O2/c1-3-15(2)21(25)23-27-20(14-29-23)22(28)26-19-12-8-17(9-13-19)5-4-16-6-10-18(24)11-7-16/h6-15,21H,3-5,24-25H2,1-2H3,(H,26,28) |
| InChIKey | ONDWIQXGVPBTKS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|