C14H24FNO — CID 176712282
4-(fluoromethylidene)-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine (PubChem CID 176712282) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is 4-(fluoromethylidene)-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine.
| Compound Name | 4-(fluoromethylidene)-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine |
|---|---|
| PubChem CID | 176712282 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 4-(fluoromethylidene)-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine |
| SMILES | CC(C)OCC1(CN2CCC(=CF)CC2)CC1 |
| InChI | InChI=1S/C14H24FNO/c1-12(2)17-11-14(5-6-14)10-16-7-3-13(9-15)4-8-16/h9,12H,3-8,10-11H2,1-2H3 |
| InChIKey | PSASVLCAKPYGOW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |