C32H41FN8 — CID 176712506
6-amino-3-butan-2-yl-2-[4-[2-[1-(dimethylamino)ethenyl]-3-fluoro-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile (PubChem CID 176712506) has the molecular formula C32H41FN8 and a molecular weight of 556.73 g/mol. Its IUPAC name is 6-amino-3-butan-2-yl-2-[4-[2-[1-(dimethylamino)ethenyl]-3-fluoro-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile.
| Compound Name | 6-amino-3-butan-2-yl-2-[4-[2-[1-(dimethylamino)ethenyl]-3-fluoro-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 176712506 |
| Molecular Formula | C32H41FN8 |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | 6-amino-3-butan-2-yl-2-[4-[2-[1-(dimethylamino)ethenyl]-3-fluoro-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile |
| SMILES | C=C(c1nn2c(c1F)CN(c1nc(CC)nc3c1CCC(c1c(C(C)CC)ccc(N)c1C#N)C3)CCC2)N(C)C |
| InChI | InChI=1S/C32H41FN8/c1-7-19(3)22-12-13-25(35)24(17-34)29(22)21-10-11-23-26(16-21)36-28(8-2)37-32(23)40-14-9-15-41-27(18-40)30(33)31(38-41)20(4)39(5)6/h12-13,19,21H,4,7-11,14-16,18,35H2,1-3,5-6H3 |
| InChIKey | RAAZKPXFFCVMMJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|