C35H51FN6O — CID 176712586
6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-[pentyl(propyl)amino]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]benzonitrile (PubChem CID 176712586) has the molecular formula C35H51FN6O and a molecular weight of 590.83 g/mol. Its IUPAC name is 6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-[pentyl(propyl)amino]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]benzonitrile.
| Compound Name | 6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-[pentyl(propyl)amino]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 176712586 |
| Molecular Formula | C35H51FN6O |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.41 |
| IUPAC Name | 6-amino-3-[(2S)-butan-2-yl]-2-[2-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]-4-[pentyl(propyl)amino]-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-7-yl]benzonitrile |
| SMILES | CCCCCN(CCC)c1nc(CC[C@@]23CCCN2CC(F)C3)nc2c1COC(c1c([C@@H](C)CC)ccc(N)c1C#N)C2 |
| InChI | InChI=1S/C35H51FN6O/c1-5-8-9-17-41(16-6-2)34-28-23-43-31(33-26(24(4)7-3)11-12-29(38)27(33)21-37)19-30(28)39-32(40-34)13-15-35-14-10-18-42(35)22-25(36)20-35/h11-12,24-25,31H,5-10,13-20,22-23,38H2,1-4H3/t24-,25?,31?,35+/m0/s1 |
| InChIKey | MGHXCEMRJCWKHP-HVJAGABSSA-N |
| XLogP | 7.17 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|