C25H37N3O4 — CID 176715576
[4-[(3Z,5E)-6-amino-4-methoxy-7-methylocta-1,3,5-trien-3-yl]piperidin-1-yl]-(4-methoxy-5-propan-2-yloxy-2-pyridinyl)methanone (PubChem CID 176715576) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is [4-[(3Z,5E)-6-amino-4-methoxy-7-methylocta-1,3,5-trien-3-yl]piperidin-1-yl]-(4-methoxy-5-propan-2-yloxy-2-pyridinyl)methanone.
| Compound Name | [4-[(3Z,5E)-6-amino-4-methoxy-7-methylocta-1,3,5-trien-3-yl]piperidin-1-yl]-(4-methoxy-5-propan-2-yloxy-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 176715576 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | [4-[(3Z,5E)-6-amino-4-methoxy-7-methylocta-1,3,5-trien-3-yl]piperidin-1-yl]-(4-methoxy-5-propan-2-yloxy-2-pyridinyl)methanone |
| SMILES | C=C/C(=C(\C=C(\N)C(C)C)OC)C1CCN(C(=O)c2cc(OC)c(OC(C)C)cn2)CC1 |
| InChI | InChI=1S/C25H37N3O4/c1-8-19(22(30-6)13-20(26)16(2)3)18-9-11-28(12-10-18)25(29)21-14-23(31-7)24(15-27-21)32-17(4)5/h8,13-18H,1,9-12,26H2,2-7H3/b20-13+,22-19- |
| InChIKey | OIPJKZZHRLHOJZ-LVENCLQRSA-N |
| XLogP | 4.31 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|