About 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one
1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 176716175) has the molecular formula C24H28O2
and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one |
| PubChem CID | 176716175 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(C)cc1CC.C=CC(=O)c1ccccc1C(C)C |
| InChI | InChI=1S/2C12H14O/c1-4-12(13)11-8-6-5-7-10(11)9(2)3;1-4-10-8-9(3)6-7-11(10)12(13)5-2/h4-9H,1H2,2-3H3;5-8H,2,4H2,1,3H3 |
| InChIKey | URAKRKFAAKPILH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one?
The IUPAC name of 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one (CID 176716175) is 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one.
What is the SMILES notation for 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one?
The canonical SMILES for 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one is C=CC(=O)c1ccc(C)cc1CC.C=CC(=O)c1ccccc1C(C)C.
What is the InChIKey of 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one?
The InChIKey is URAKRKFAAKPILH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H14O/c1-4-12(13)11-8-6-5-7-10(11)9(2)3;1-4-10-8-9(3)6-7-11(10)12(13)5-2/h4-9H,1H2,2-3H3;5-8H,2,4H2,1,3H3.
What are the key properties of 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one?
1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one has a molecular weight of 348.49 g/mol, XLogP of 6.10, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethyl-4-methylphenyl)prop-2-en-1-one;1-(2-propan-2-ylphenyl)prop-2-en-1-one is sourced from PubChem (CID 176716175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).