C8H11F2N3 — CID 176717528
3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutan-1-amine (PubChem CID 176717528) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutan-1-amine.
| Compound Name | 3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 176717528 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutan-1-amine |
| SMILES | NC1CC(n2nccc2C(F)F)C1 |
| InChI | InChI=1S/C8H11F2N3/c9-8(10)7-1-2-12-13(7)6-3-5(11)4-6/h1-2,5-6,8H,3-4,11H2 |
| InChIKey | INDHHYVPLNZZJO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |