C17H19F3N4O2 — CID 176717856
1-cyclobutyl-2-(trifluoromethyl)benzimidazole;ethenyl(methyliminomethyl)carbamic acid (PubChem CID 176717856) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-cyclobutyl-2-(trifluoromethyl)benzimidazole;ethenyl(methyliminomethyl)carbamic acid.
| Compound Name | 1-cyclobutyl-2-(trifluoromethyl)benzimidazole;ethenyl(methyliminomethyl)carbamic acid |
|---|---|
| PubChem CID | 176717856 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-cyclobutyl-2-(trifluoromethyl)benzimidazole;ethenyl(methyliminomethyl)carbamic acid |
| SMILES | C=CN(/C=N/C)C(=O)O.FC(F)(F)c1nc2ccccc2n1C1CCC1 |
| InChI | InChI=1S/C12H11F3N2.C5H8N2O2/c13-12(14,15)11-16-9-6-1-2-7-10(9)17(11)8-4-3-5-8;1-3-7(4-6-2)5(8)9/h1-2,6-8H,3-5H2;3-4H,1H2,2H3,(H,8,9)/b;6-4+ |
| InChIKey | WVNDUYVNJMQFDD-DVXCEAISSA-N |
| XLogP | 4.55 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|