About 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile
2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile (PubChem CID 119054488) has the molecular formula C12H9F2N3
and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile.
Molecular Properties
| Compound Name | 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile |
| PubChem CID | 119054488 |
| Molecular Formula | C12H9F2N3 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile |
| SMILES | N#CC(F)(F)c1nc2ccccc2n1C1CC1 |
| InChI | InChI=1S/C12H9F2N3/c13-12(14,7-15)11-16-9-3-1-2-4-10(9)17(11)8-5-6-8/h1-4,8H,5-6H2 |
| InChIKey | XFCAIGKPHJETAZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile?
The IUPAC name of 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile (CID 119054488) is 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile.
What is the SMILES notation for 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile?
The canonical SMILES for 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile is N#CC(F)(F)c1nc2ccccc2n1C1CC1.
What is the InChIKey of 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile?
The InChIKey is XFCAIGKPHJETAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2N3/c13-12(14,7-15)11-16-9-3-1-2-4-10(9)17(11)8-5-6-8/h1-4,8H,5-6H2.
What are the key properties of 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile?
2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile has a molecular weight of 233.22 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropylbenzimidazol-2-yl)-2,2-difluoroacetonitrile is sourced from PubChem (CID 119054488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).