C13H9F4N3 — CID 79659766
1-cyclopropyl-2-(1,1,2,2-tetrafluoroethyl)benzimidazole-5-carbonitrile (PubChem CID 79659766) has the molecular formula C13H9F4N3 and a molecular weight of 283.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-(1,1,2,2-tetrafluoroethyl)benzimidazole-5-carbonitrile.
| Compound Name | 1-cyclopropyl-2-(1,1,2,2-tetrafluoroethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 79659766 |
| Molecular Formula | C13H9F4N3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-cyclopropyl-2-(1,1,2,2-tetrafluoroethyl)benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)nc(C(F)(F)C(F)F)n2C1CC1 |
| InChI | InChI=1S/C13H9F4N3/c14-11(15)13(16,17)12-19-9-5-7(6-18)1-4-10(9)20(12)8-2-3-8/h1,4-5,8,11H,2-3H2 |
| InChIKey | CRZCZICAYXORRJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|