C16H13N3O — CID 114823633
1-cyclopropyl-2-(5-methylfuran-3-yl)benzimidazole-5-carbonitrile (PubChem CID 114823633) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-cyclopropyl-2-(5-methylfuran-3-yl)benzimidazole-5-carbonitrile.
| Compound Name | 1-cyclopropyl-2-(5-methylfuran-3-yl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 114823633 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-cyclopropyl-2-(5-methylfuran-3-yl)benzimidazole-5-carbonitrile |
| SMILES | Cc1cc(-c2nc3cc(C#N)ccc3n2C2CC2)co1 |
| InChI | InChI=1S/C16H13N3O/c1-10-6-12(9-20-10)16-18-14-7-11(8-17)2-5-15(14)19(16)13-3-4-13/h2,5-7,9,13H,3-4H2,1H3 |
| InChIKey | PSIVNNJFQVGBTP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |