C13H12N2 — CID 115020693
1-cyclopropyl-2-methylindole-6-carbonitrile (PubChem CID 115020693) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-methylindole-6-carbonitrile.
| Compound Name | 1-cyclopropyl-2-methylindole-6-carbonitrile |
|---|---|
| PubChem CID | 115020693 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopropyl-2-methylindole-6-carbonitrile |
| SMILES | Cc1cc2ccc(C#N)cc2n1C1CC1 |
| InChI | InChI=1S/C13H12N2/c1-9-6-11-3-2-10(8-14)7-13(11)15(9)12-4-5-12/h2-3,6-7,12H,4-5H2,1H3 |
| InChIKey | SAHYFKXDIRRWQP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |