C19H16N4 — CID 135188054
1-cyclopropyl-2-(6-cyclopropylpyridazin-4-yl)indole-6-carbonitrile (PubChem CID 135188054) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-cyclopropyl-2-(6-cyclopropylpyridazin-4-yl)indole-6-carbonitrile.
| Compound Name | 1-cyclopropyl-2-(6-cyclopropylpyridazin-4-yl)indole-6-carbonitrile |
|---|---|
| PubChem CID | 135188054 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-cyclopropyl-2-(6-cyclopropylpyridazin-4-yl)indole-6-carbonitrile |
| SMILES | N#Cc1ccc2cc(-c3cnnc(C4CC4)c3)n(C3CC3)c2c1 |
| InChI | InChI=1S/C19H16N4/c20-10-12-1-2-14-9-19(23(16-5-6-16)18(14)7-12)15-8-17(13-3-4-13)22-21-11-15/h1-2,7-9,11,13,16H,3-6H2 |
| InChIKey | KHZFTWLTZNJLNY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |