C16H17N3O — CID 79756124
1-cyclopropyl-2-(2-methyloxolan-3-yl)benzimidazole-5-carbonitrile (PubChem CID 79756124) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-methyloxolan-3-yl)benzimidazole-5-carbonitrile.
| Compound Name | 1-cyclopropyl-2-(2-methyloxolan-3-yl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 79756124 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-cyclopropyl-2-(2-methyloxolan-3-yl)benzimidazole-5-carbonitrile |
| SMILES | CC1OCCC1c1nc2cc(C#N)ccc2n1C1CC1 |
| InChI | InChI=1S/C16H17N3O/c1-10-13(6-7-20-10)16-18-14-8-11(9-17)2-5-15(14)19(16)12-3-4-12/h2,5,8,10,12-13H,3-4,6-7H2,1H3 |
| InChIKey | PXIWYOGGBVZABP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |